C25H33NO5Si — CID 101189039
methyl 2-[(2S,3S)-2-[(1S)-1-[tert-butyl(diphenyl)silyl]oxyethyl]-3-methoxy-4-oxoazetidin-1-yl]acetate (PubChem CID 101189039) has the molecular formula C25H33NO5Si and a molecular weight of 455.63 g/mol. Its IUPAC name is methyl 2-[(2S,3S)-2-[(1S)-1-[tert-butyl(diphenyl)silyl]oxyethyl]-3-methoxy-4-oxoazetidin-1-yl]acetate.
| Compound Name | methyl 2-[(2S,3S)-2-[(1S)-1-[tert-butyl(diphenyl)silyl]oxyethyl]-3-methoxy-4-oxoazetidin-1-yl]acetate |
|---|---|
| PubChem CID | 101189039 |
| Molecular Formula | C25H33NO5Si |
| Molecular Weight | 455.63 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | methyl 2-[(2S,3S)-2-[(1S)-1-[tert-butyl(diphenyl)silyl]oxyethyl]-3-methoxy-4-oxoazetidin-1-yl]acetate |
| SMILES | COC(=O)CN1C(=O)[C@@H](OC)[C@H]1[C@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H33NO5Si/c1-18(22-23(30-6)24(28)26(22)17-21(27)29-5)31-32(25(2,3)4,19-13-9-7-10-14-19)20-15-11-8-12-16-20/h7-16,18,22-23H,17H2,1-6H3/t18-,22+,23-/m0/s1 |
| InChIKey | VLDMDQYKIOWJNI-NMNUPHIUSA-N |
| XLogP | 2.35 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.63 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|