C23H35NO4SSi — CID 76501200
methyl 2-[3-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-(1-phenyl-1-sulfanylidenepropan-2-yl)azetidin-1-yl]acetate (PubChem CID 76501200) has the molecular formula C23H35NO4SSi and a molecular weight of 449.69 g/mol. Its IUPAC name is methyl 2-[3-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-(1-phenyl-1-sulfanylidenepropan-2-yl)azetidin-1-yl]acetate.
| Compound Name | methyl 2-[3-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-(1-phenyl-1-sulfanylidenepropan-2-yl)azetidin-1-yl]acetate |
|---|---|
| PubChem CID | 76501200 |
| Molecular Formula | C23H35NO4SSi |
| Molecular Weight | 449.69 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | methyl 2-[3-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-(1-phenyl-1-sulfanylidenepropan-2-yl)azetidin-1-yl]acetate |
| SMILES | COC(=O)CN1C(=O)C(C(C)O[Si](C)(C)C(C)(C)C)C1C(C)C(=S)c1ccccc1 |
| InChI | InChI=1S/C23H35NO4SSi/c1-15(21(29)17-12-10-9-11-13-17)20-19(22(26)24(20)14-18(25)27-6)16(2)28-30(7,8)23(3,4)5/h9-13,15-16,19-20H,14H2,1-8H3 |
| InChIKey | XLOMBCNLIBXCIL-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.69 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|