C26H41NO5SSi — CID 88680028
tert-butyl 2-[(3S,4S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-[(1R)-3-oxo-1-phenylsulfanylpropyl]azetidin-1-yl]acetate (PubChem CID 88680028) has the molecular formula C26H41NO5SSi and a molecular weight of 507.77 g/mol. Its IUPAC name is tert-butyl 2-[(3S,4S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-[(1R)-3-oxo-1-phenylsulfanylpropyl]azetidin-1-yl]acetate.
| Compound Name | tert-butyl 2-[(3S,4S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-[(1R)-3-oxo-1-phenylsulfanylpropyl]azetidin-1-yl]acetate |
|---|---|
| PubChem CID | 88680028 |
| Molecular Formula | C26H41NO5SSi |
| Molecular Weight | 507.77 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | tert-butyl 2-[(3S,4S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-[(1R)-3-oxo-1-phenylsulfanylpropyl]azetidin-1-yl]acetate |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C(=O)N(CC(=O)OC(C)(C)C)[C@@H]1[C@@H](CC=O)Sc1ccccc1 |
| InChI | InChI=1S/C26H41NO5SSi/c1-18(32-34(8,9)26(5,6)7)22-23(20(15-16-28)33-19-13-11-10-12-14-19)27(24(22)30)17-21(29)31-25(2,3)4/h10-14,16,18,20,22-23H,15,17H2,1-9H3/t18-,20-,22-,23-/m1/s1 |
| InChIKey | KEVIOQZSOXWNRO-KPUOSGPGSA-N |
| XLogP | 5.32 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.77 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|