C26H33NO6Si — CID 67850594
[(2R,3R)-2-benzoyloxy-3-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-1-yl]methyl benzoate (PubChem CID 67850594) has the molecular formula C26H33NO6Si and a molecular weight of 483.64 g/mol. Its IUPAC name is [(2R,3R)-2-benzoyloxy-3-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-1-yl]methyl benzoate.
| Compound Name | [(2R,3R)-2-benzoyloxy-3-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-1-yl]methyl benzoate |
|---|---|
| PubChem CID | 67850594 |
| Molecular Formula | C26H33NO6Si |
| Molecular Weight | 483.64 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | [(2R,3R)-2-benzoyloxy-3-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-1-yl]methyl benzoate |
| SMILES | CC(O[Si](C)(C)C(C)(C)C)[C@H]1C(=O)N(COC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H33NO6Si/c1-18(33-34(5,6)26(2,3)4)21-22(28)27(17-31-24(29)19-13-9-7-10-14-19)23(21)32-25(30)20-15-11-8-12-16-20/h7-16,18,21,23H,17H2,1-6H3/t18?,21-,23+/m0/s1 |
| InChIKey | FSOFOOOBIFICJZ-DNPUCPKASA-N |
| XLogP | 4.85 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.64 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|