C23H31NO6Si — CID 101256510
ethyl 2-[(3S,4Z)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-phenacylideneazetidin-1-yl]-2-oxoacetate (PubChem CID 101256510) has the molecular formula C23H31NO6Si and a molecular weight of 445.59 g/mol. Its IUPAC name is ethyl 2-[(3S,4Z)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-phenacylideneazetidin-1-yl]-2-oxoacetate.
| Compound Name | ethyl 2-[(3S,4Z)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-phenacylideneazetidin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 101256510 |
| Molecular Formula | C23H31NO6Si |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | ethyl 2-[(3S,4Z)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-phenacylideneazetidin-1-yl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)N1C(=O)[C@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)/C1=C/C(=O)c1ccccc1 |
| InChI | InChI=1S/C23H31NO6Si/c1-8-29-22(28)21(27)24-17(14-18(25)16-12-10-9-11-13-16)19(20(24)26)15(2)30-31(6,7)23(3,4)5/h9-15,19H,8H2,1-7H3/b17-14-/t15-,19-/m1/s1 |
| InChIKey | BZWZCOTWXOSAMZ-QVAPPRMQSA-N |
| XLogP | 3.71 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|