C21H32N2O2SSi — CID 122387179
(3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-N-phenyl-4-prop-2-enylazetidine-1-carbothioamide (PubChem CID 122387179) has the molecular formula C21H32N2O2SSi and a molecular weight of 404.65 g/mol. Its IUPAC name is (3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-N-phenyl-4-prop-2-enylazetidine-1-carbothioamide.
| Compound Name | (3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-N-phenyl-4-prop-2-enylazetidine-1-carbothioamide |
|---|---|
| PubChem CID | 122387179 |
| Molecular Formula | C21H32N2O2SSi |
| Molecular Weight | 404.65 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | (3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-N-phenyl-4-prop-2-enylazetidine-1-carbothioamide |
| SMILES | C=CC[C@@H]1[C@@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)C(=O)N1C(=S)Nc1ccccc1 |
| InChI | InChI=1S/C21H32N2O2SSi/c1-8-12-17-18(15(2)25-27(6,7)21(3,4)5)19(24)23(17)20(26)22-16-13-10-9-11-14-16/h8-11,13-15,17-18H,1,12H2,2-7H3,(H,22,26)/t15-,17-,18-/m1/s1 |
| InChIKey | YQAZOHCVTVSXPU-KBAYOESNSA-N |
| XLogP | 5.20 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.65 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|