C21H29ClN2O2SSi — CID 132531774
(3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-N-(4-chlorophenyl)-2-oxo-4-prop-2-ynylazetidine-1-carbothioamide (PubChem CID 132531774) has the molecular formula C21H29ClN2O2SSi and a molecular weight of 437.08 g/mol. Its IUPAC name is (3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-N-(4-chlorophenyl)-2-oxo-4-prop-2-ynylazetidine-1-carbothioamide.
| Compound Name | (3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-N-(4-chlorophenyl)-2-oxo-4-prop-2-ynylazetidine-1-carbothioamide |
|---|---|
| PubChem CID | 132531774 |
| Molecular Formula | C21H29ClN2O2SSi |
| Molecular Weight | 437.08 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | (3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-N-(4-chlorophenyl)-2-oxo-4-prop-2-ynylazetidine-1-carbothioamide |
| SMILES | C#CC[C@@H]1[C@@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)C(=O)N1C(=S)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H29ClN2O2SSi/c1-8-9-17-18(14(2)26-28(6,7)21(3,4)5)19(25)24(17)20(27)23-16-12-10-15(22)11-13-16/h1,10-14,17-18H,9H2,2-7H3,(H,23,27)/t14-,17-,18-/m1/s1 |
| InChIKey | JVWFPYJJWVDDDD-ZTFGCOKTSA-N |
| XLogP | 5.30 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.08 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|