About CID 102521073
CID 102521073 (PubChem CID 102521073) has the molecular formula C22H30ClN2O2SeSi
and a molecular weight of 496.99 g/mol.
Molecular Properties
| Compound Name | CID 102521073 |
| PubChem CID | 102521073 |
| Molecular Formula | C22H30ClN2O2SeSi |
| Molecular Weight | 496.99 g/mol |
| Exact Mass | 497.09 |
| IUPAC Name | — |
| SMILES | C=C=C(C)[C@@H]1[C@@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)C(=O)N1/C([Se])=N/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H30ClN2O2SeSi/c1-9-14(2)19-18(15(3)27-29(7,8)22(4,5)6)20(26)25(19)21(28)24-17-12-10-16(23)11-13-17/h10-13,15,18-19H,1H2,2-8H3/b24-21-/t15-,18-,19-/m1/s1 |
| InChIKey | MBYOWCQFEFZPLJ-KPIIVQATSA-N |
| XLogP | 5.46 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 496.99 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze CID 102521073 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102521073?
The IUPAC name of CID 102521073 (CID 102521073) is not available.
What is the SMILES notation for CID 102521073?
The canonical SMILES for CID 102521073 is C=C=C(C)[C@@H]1[C@@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)C(=O)N1/C([Se])=N/c1ccc(Cl)cc1.
What is the InChIKey of CID 102521073?
The InChIKey is MBYOWCQFEFZPLJ-KPIIVQATSA-N. The full InChI is InChI=1S/C22H30ClN2O2SeSi/c1-9-14(2)19-18(15(3)27-29(7,8)22(4,5)6)20(26)25(19)21(28)24-17-12-10-16(23)11-13-17/h10-13,15,18-19H,1H2,2-8H3/b24-21-/t15-,18-,19-/m1/s1.
What are the key properties of CID 102521073?
CID 102521073 has a molecular weight of 496.99 g/mol, XLogP of 5.46, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102521073 is sourced from PubChem (CID 102521073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).