C22H30ClN2O2SeSi — CID 102521073
CID 102521073 (PubChem CID 102521073) has the molecular formula C22H30ClN2O2SeSi and a molecular weight of 496.99 g/mol.
| Compound Name | CID 102521073 |
|---|---|
| PubChem CID | 102521073 |
| Molecular Formula | C22H30ClN2O2SeSi |
| Molecular Weight | 496.99 g/mol |
| Exact Mass | 497.09 |
| IUPAC Name | — |
| SMILES | C=C=C(C)[C@@H]1[C@@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)C(=O)N1/C([Se])=N/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H30ClN2O2SeSi/c1-9-14(2)19-18(15(3)27-29(7,8)22(4,5)6)20(26)25(19)21(28)24-17-12-10-16(23)11-13-17/h10-13,15,18-19H,1H2,2-8H3/b24-21-/t15-,18-,19-/m1/s1 |
| InChIKey | MBYOWCQFEFZPLJ-KPIIVQATSA-N |
| XLogP | 5.46 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.99 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|