C20H41NO3Si2 — CID 11069396
(2R)-2-[(2R,3R)-1-[tert-butyl(dimethyl)silyl]-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]propanal (PubChem CID 11069396) has the molecular formula C20H41NO3Si2 and a molecular weight of 399.72 g/mol. Its IUPAC name is (2R)-2-[(2R,3R)-1-[tert-butyl(dimethyl)silyl]-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]propanal.
| Compound Name | (2R)-2-[(2R,3R)-1-[tert-butyl(dimethyl)silyl]-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]propanal |
|---|---|
| PubChem CID | 11069396 |
| Molecular Formula | C20H41NO3Si2 |
| Molecular Weight | 399.72 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | (2R)-2-[(2R,3R)-1-[tert-butyl(dimethyl)silyl]-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]propanal |
| SMILES | C[C@@H](C=O)[C@@H]1[C@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H41NO3Si2/c1-14(13-22)17-16(15(2)24-26(11,12)20(6,7)8)18(23)21(17)25(9,10)19(3,4)5/h13-17H,1-12H3/t14-,15+,16-,17+/m0/s1 |
| InChIKey | KYODVYXAEDTXOG-VVLHAWIVSA-N |
| XLogP | 5.06 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.72 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|