C15H31NO4SSi — CID 67931664
3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-tert-butylsulfonylazetidin-2-one (PubChem CID 67931664) has the molecular formula C15H31NO4SSi and a molecular weight of 349.57 g/mol. Its IUPAC name is 3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-tert-butylsulfonylazetidin-2-one.
| Compound Name | 3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-tert-butylsulfonylazetidin-2-one |
|---|---|
| PubChem CID | 67931664 |
| Molecular Formula | C15H31NO4SSi |
| Molecular Weight | 349.57 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-tert-butylsulfonylazetidin-2-one |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)C1C(=O)NC1S(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C15H31NO4SSi/c1-10(20-22(8,9)15(5,6)7)11-12(17)16-13(11)21(18,19)14(2,3)4/h10-11,13H,1-9H3,(H,16,17)/t10-,11?,13?/m1/s1 |
| InChIKey | DOYGMBXFWUFJRC-XSRFYTQQSA-N |
| XLogP | 2.68 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.57 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|