C28H48N2O7Si2 — CID 70527695
4-[(2R,3S)-1-[tert-butyl(dimethyl)silyl]-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-3-hydroxy-2-[(4-nitrophenyl)methyl]butanoic acid (PubChem CID 70527695) has the molecular formula C28H48N2O7Si2 and a molecular weight of 580.87 g/mol. Its IUPAC name is 4-[(2R,3S)-1-[tert-butyl(dimethyl)silyl]-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-3-hydroxy-2-[(4-nitrophenyl)methyl]butanoic acid.
| Compound Name | 4-[(2R,3S)-1-[tert-butyl(dimethyl)silyl]-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-3-hydroxy-2-[(4-nitrophenyl)methyl]butanoic acid |
|---|---|
| PubChem CID | 70527695 |
| Molecular Formula | C28H48N2O7Si2 |
| Molecular Weight | 580.87 g/mol |
| Exact Mass | 580.30 |
| IUPAC Name | 4-[(2R,3S)-1-[tert-butyl(dimethyl)silyl]-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-3-hydroxy-2-[(4-nitrophenyl)methyl]butanoic acid |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C(=O)N([Si](C)(C)C(C)(C)C)[C@@H]1CC(O)C(Cc1ccc([N+](=O)[O-])cc1)C(=O)O |
| InChI | InChI=1S/C28H48N2O7Si2/c1-18(37-39(10,11)28(5,6)7)24-22(29(25(24)32)38(8,9)27(2,3)4)17-23(31)21(26(33)34)16-19-12-14-20(15-13-19)30(35)36/h12-15,18,21-24,31H,16-17H2,1-11H3,(H,33,34)/t18-,21?,22-,23?,24-/m1/s1 |
| InChIKey | QQPLJWGZJCYHAA-JGBTUKTPSA-N |
| XLogP | 5.83 |
| TPSA | 130.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.87 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|