C24H34N6O8S2Si — CID 88734601
(4-nitrophenyl)methyl 2-[(2R,3R)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-[2-(1-methyltetrazol-5-yl)sulfanylacetyl]sulfanyl-4-oxoazetidin-1-yl]-2-hydroxyacetate (PubChem CID 88734601) has the molecular formula C24H34N6O8S2Si and a molecular weight of 626.79 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-[(2R,3R)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-[2-(1-methyltetrazol-5-yl)sulfanylacetyl]sulfanyl-4-oxoazetidin-1-yl]-2-hydroxyacetate.
| Compound Name | (4-nitrophenyl)methyl 2-[(2R,3R)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-[2-(1-methyltetrazol-5-yl)sulfanylacetyl]sulfanyl-4-oxoazetidin-1-yl]-2-hydroxyacetate |
|---|---|
| PubChem CID | 88734601 |
| Molecular Formula | C24H34N6O8S2Si |
| Molecular Weight | 626.79 g/mol |
| Exact Mass | 626.16 |
| IUPAC Name | (4-nitrophenyl)methyl 2-[(2R,3R)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-[2-(1-methyltetrazol-5-yl)sulfanylacetyl]sulfanyl-4-oxoazetidin-1-yl]-2-hydroxyacetate |
| SMILES | C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C(=O)N(C(O)C(=O)OCc2ccc([N+](=O)[O-])cc2)[C@@H]1SC(=O)CSc1nnnn1C |
| InChI | InChI=1S/C24H34N6O8S2Si/c1-14(38-41(6,7)24(2,3)4)18-19(32)29(21(18)40-17(31)13-39-23-25-26-27-28(23)5)20(33)22(34)37-12-15-8-10-16(11-9-15)30(35)36/h8-11,14,18,20-21,33H,12-13H2,1-7H3/t14-,18+,20?,21+/m0/s1 |
| InChIKey | LMRHTIMEKKMREC-LSMJVOJFSA-N |
| XLogP | 2.73 |
| TPSA | 179.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.79 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|