C23H32N2O7S3Si — CID 13476338
(4-nitrophenyl)methyl 2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-ethylsulfanylcarbothioylsulfanyl-4-oxoazetidin-1-yl]-2-oxoacetate (PubChem CID 13476338) has the molecular formula C23H32N2O7S3Si and a molecular weight of 572.80 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-ethylsulfanylcarbothioylsulfanyl-4-oxoazetidin-1-yl]-2-oxoacetate.
| Compound Name | (4-nitrophenyl)methyl 2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-ethylsulfanylcarbothioylsulfanyl-4-oxoazetidin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 13476338 |
| Molecular Formula | C23H32N2O7S3Si |
| Molecular Weight | 572.80 g/mol |
| Exact Mass | 572.11 |
| IUPAC Name | (4-nitrophenyl)methyl 2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-ethylsulfanylcarbothioylsulfanyl-4-oxoazetidin-1-yl]-2-oxoacetate |
| SMILES | CCSC(=S)S[C@@H]1[C@@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)C(=O)N1C(=O)C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H32N2O7S3Si/c1-8-34-22(33)35-20-17(14(2)32-36(6,7)23(3,4)5)18(26)24(20)19(27)21(28)31-13-15-9-11-16(12-10-15)25(29)30/h9-12,14,17,20H,8,13H2,1-7H3/t14-,17+,20-/m1/s1 |
| InChIKey | JQFCJXYLCMSOJV-CFLQYTFWSA-N |
| XLogP | 5.13 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.80 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|