C24H38N2O6SSi2 — CID 10951633
2-trimethylsilylethyl 2-[(3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-(pyridine-4-carbonylsulfanyl)azetidin-1-yl]-2-oxoacetate (PubChem CID 10951633) has the molecular formula C24H38N2O6SSi2 and a molecular weight of 538.82 g/mol. Its IUPAC name is 2-trimethylsilylethyl 2-[(3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-(pyridine-4-carbonylsulfanyl)azetidin-1-yl]-2-oxoacetate.
| Compound Name | 2-trimethylsilylethyl 2-[(3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-(pyridine-4-carbonylsulfanyl)azetidin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 10951633 |
| Molecular Formula | C24H38N2O6SSi2 |
| Molecular Weight | 538.82 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | 2-trimethylsilylethyl 2-[(3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-(pyridine-4-carbonylsulfanyl)azetidin-1-yl]-2-oxoacetate |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C(=O)N(C(=O)C(=O)OCC[Si](C)(C)C)[C@@H]1SC(=O)c1ccncc1 |
| InChI | InChI=1S/C24H38N2O6SSi2/c1-16(32-35(8,9)24(2,3)4)18-19(27)26(20(28)22(29)31-14-15-34(5,6)7)21(18)33-23(30)17-10-12-25-13-11-17/h10-13,16,18,21H,14-15H2,1-9H3/t16-,18+,21-/m1/s1 |
| InChIKey | YDKUENGYPQVQAC-PLMTUMEDSA-N |
| XLogP | 4.56 |
| TPSA | 102.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.82 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|