C23H37NO7SSi2 — CID 10885914
2-trimethylsilylethyl 2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(furan-2-carbonylsulfanyl)-4-oxoazetidin-1-yl]-2-oxoacetate (PubChem CID 10885914) has the molecular formula C23H37NO7SSi2 and a molecular weight of 527.79 g/mol. Its IUPAC name is 2-trimethylsilylethyl 2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(furan-2-carbonylsulfanyl)-4-oxoazetidin-1-yl]-2-oxoacetate.
| Compound Name | 2-trimethylsilylethyl 2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(furan-2-carbonylsulfanyl)-4-oxoazetidin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 10885914 |
| Molecular Formula | C23H37NO7SSi2 |
| Molecular Weight | 527.79 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | 2-trimethylsilylethyl 2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(furan-2-carbonylsulfanyl)-4-oxoazetidin-1-yl]-2-oxoacetate |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C(=O)N(C(=O)C(=O)OCC[Si](C)(C)C)[C@@H]1SC(=O)c1ccco1 |
| InChI | InChI=1S/C23H37NO7SSi2/c1-15(31-34(8,9)23(2,3)4)17-18(25)24(19(26)21(27)30-13-14-33(5,6)7)20(17)32-22(28)16-11-10-12-29-16/h10-12,15,17,20H,13-14H2,1-9H3/t15-,17+,20-/m1/s1 |
| InChIKey | BHZBXCGKJGIVQP-OXFYSEKESA-N |
| XLogP | 4.76 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.79 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|