C16H29NO4S2Si — CID 102260634
O-ethyl [(2R,3S)-1-acetyl-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]sulfanylmethanethioate (PubChem CID 102260634) has the molecular formula C16H29NO4S2Si and a molecular weight of 391.63 g/mol. Its IUPAC name is O-ethyl [(2R,3S)-1-acetyl-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]sulfanylmethanethioate.
| Compound Name | O-ethyl [(2R,3S)-1-acetyl-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]sulfanylmethanethioate |
|---|---|
| PubChem CID | 102260634 |
| Molecular Formula | C16H29NO4S2Si |
| Molecular Weight | 391.63 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | O-ethyl [(2R,3S)-1-acetyl-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]sulfanylmethanethioate |
| SMILES | CCOC(=S)S[C@@H]1[C@@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)C(=O)N1C(C)=O |
| InChI | InChI=1S/C16H29NO4S2Si/c1-9-20-15(22)23-14-12(13(19)17(14)11(3)18)10(2)21-24(7,8)16(4,5)6/h10,12,14H,9H2,1-8H3/t10-,12+,14-/m1/s1 |
| InChIKey | IJRLNWWEKNRYNO-SCDSUCTJSA-N |
| XLogP | 3.78 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.63 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|