C23H34N2O7Si — CID 58813283
(4-nitrophenyl)methyl (4R)-4-[3-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-3-oxopentanoate (PubChem CID 58813283) has the molecular formula C23H34N2O7Si and a molecular weight of 478.62 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (4R)-4-[3-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-3-oxopentanoate.
| Compound Name | (4-nitrophenyl)methyl (4R)-4-[3-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-3-oxopentanoate |
|---|---|
| PubChem CID | 58813283 |
| Molecular Formula | C23H34N2O7Si |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | (4-nitrophenyl)methyl (4R)-4-[3-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-3-oxopentanoate |
| SMILES | CC(O[Si](C)(C)C(C)(C)C)C1C(=O)NC1[C@@H](C)C(=O)CC(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H34N2O7Si/c1-14(21-20(22(28)24-21)15(2)32-33(6,7)23(3,4)5)18(26)12-19(27)31-13-16-8-10-17(11-9-16)25(29)30/h8-11,14-15,20-21H,12-13H2,1-7H3,(H,24,28)/t14-,15?,20?,21?/m0/s1 |
| InChIKey | ANRSPPUCDKCRMR-XFMWWGCHSA-N |
| XLogP | 3.76 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|