C22H36N2O6SSi — CID 88650534
(4-nitrophenyl)methyl 2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-ethylsulfanyl-1-oxidoazetidin-1-ium-1-yl]acetate (PubChem CID 88650534) has the molecular formula C22H36N2O6SSi and a molecular weight of 484.69 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-ethylsulfanyl-1-oxidoazetidin-1-ium-1-yl]acetate.
| Compound Name | (4-nitrophenyl)methyl 2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-ethylsulfanyl-1-oxidoazetidin-1-ium-1-yl]acetate |
|---|---|
| PubChem CID | 88650534 |
| Molecular Formula | C22H36N2O6SSi |
| Molecular Weight | 484.69 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | (4-nitrophenyl)methyl 2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-ethylsulfanyl-1-oxidoazetidin-1-ium-1-yl]acetate |
| SMILES | CCS[C@@H]1[C@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)C[N+]1([O-])CC(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H36N2O6SSi/c1-8-31-21-19(16(2)30-32(6,7)22(3,4)5)13-24(21,28)14-20(25)29-15-17-9-11-18(12-10-17)23(26)27/h9-12,16,19,21H,8,13-15H2,1-7H3/t16-,19+,21-,24?/m1/s1 |
| InChIKey | BCNFFIGDLLHXMS-IZOMLDNVSA-N |
| XLogP | 5.07 |
| TPSA | 101.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.69 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|