C22H30N2O6S2Si — CID 70397949
(5R)-6-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-3-methylsulfanyl-5-[(4-nitrophenyl)methyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 70397949) has the molecular formula C22H30N2O6S2Si and a molecular weight of 510.71 g/mol. Its IUPAC name is (5R)-6-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-3-methylsulfanyl-5-[(4-nitrophenyl)methyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (5R)-6-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-3-methylsulfanyl-5-[(4-nitrophenyl)methyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 70397949 |
| Molecular Formula | C22H30N2O6S2Si |
| Molecular Weight | 510.71 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | (5R)-6-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-3-methylsulfanyl-5-[(4-nitrophenyl)methyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | CSC1=C(C(=O)O)N2C(=O)C(C(C)O[Si](C)(C)C(C)(C)C)[C@@]2(Cc2ccc([N+](=O)[O-])cc2)S1 |
| InChI | InChI=1S/C22H30N2O6S2Si/c1-13(30-33(6,7)21(2,3)4)16-18(25)23-17(19(26)27)20(31-5)32-22(16,23)12-14-8-10-15(11-9-14)24(28)29/h8-11,13,16H,12H2,1-7H3,(H,26,27)/t13?,16?,22-/m1/s1 |
| InChIKey | TYXQYSKVGFVNFS-IHPFUDPJSA-N |
| XLogP | 5.07 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.71 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|