C23H32N2O7S2Si — CID 154413637
(5R,6S)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-3-ethylsulfinyl-5-[(4-nitrophenyl)methyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 154413637) has the molecular formula C23H32N2O7S2Si and a molecular weight of 540.74 g/mol. Its IUPAC name is (5R,6S)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-3-ethylsulfinyl-5-[(4-nitrophenyl)methyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (5R,6S)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-3-ethylsulfinyl-5-[(4-nitrophenyl)methyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 154413637 |
| Molecular Formula | C23H32N2O7S2Si |
| Molecular Weight | 540.74 g/mol |
| Exact Mass | 540.14 |
| IUPAC Name | (5R,6S)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-3-ethylsulfinyl-5-[(4-nitrophenyl)methyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | CCS(=O)C1=C(C(=O)O)N2C(=O)[C@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)[C@@]2(Cc2ccc([N+](=O)[O-])cc2)S1 |
| InChI | InChI=1S/C23H32N2O7S2Si/c1-8-34(31)21-18(20(27)28)24-19(26)17(14(2)32-35(6,7)22(3,4)5)23(24,33-21)13-15-9-11-16(12-10-15)25(29)30/h9-12,14,17H,8,13H2,1-7H3,(H,27,28)/t14-,17+,23-,34?/m1/s1 |
| InChIKey | JGSMRQCRIRYGQP-LIGKCKGISA-N |
| XLogP | 4.47 |
| TPSA | 127.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.74 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|