C28H25N3O13S — CID 154413336
(5R,6S)-6-[(1R)-1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-5-[(4-nitrophenyl)methyl]-7-oxo-3-(3-oxobutanoyloxymethyl)-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 154413336) has the molecular formula C28H25N3O13S and a molecular weight of 643.58 g/mol. Its IUPAC name is (5R,6S)-6-[(1R)-1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-5-[(4-nitrophenyl)methyl]-7-oxo-3-(3-oxobutanoyloxymethyl)-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (5R,6S)-6-[(1R)-1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-5-[(4-nitrophenyl)methyl]-7-oxo-3-(3-oxobutanoyloxymethyl)-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 154413336 |
| Molecular Formula | C28H25N3O13S |
| Molecular Weight | 643.58 g/mol |
| Exact Mass | 643.11 |
| IUPAC Name | (5R,6S)-6-[(1R)-1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-5-[(4-nitrophenyl)methyl]-7-oxo-3-(3-oxobutanoyloxymethyl)-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | CC(=O)CC(=O)OCC1=C(C(=O)O)N2C(=O)[C@H]([C@@H](C)OC(=O)OCc3ccc([N+](=O)[O-])cc3)[C@@]2(Cc2ccc([N+](=O)[O-])cc2)S1 |
| InChI | InChI=1S/C28H25N3O13S/c1-15(32)11-22(33)42-14-21-24(26(35)36)29-25(34)23(28(29,45-21)12-17-3-7-19(8-4-17)30(38)39)16(2)44-27(37)43-13-18-5-9-20(10-6-18)31(40)41/h3-10,16,23H,11-14H2,1-2H3,(H,35,36)/t16-,23+,28-/m1/s1 |
| InChIKey | YZKMRHWQKBBKKH-NGILUBTISA-N |
| XLogP | 3.51 |
| TPSA | 222.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.58 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|