C31H33N3O12 — CID 57090914
methyl 3-methyl-2-[2-[2-methylidene-4-[(4-nitrophenyl)methoxy]-4-oxobutyl]-3-[(1S)-1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-4-oxoazetidin-1-yl]but-2-enoate (PubChem CID 57090914) has the molecular formula C31H33N3O12 and a molecular weight of 639.61 g/mol. Its IUPAC name is methyl 3-methyl-2-[2-[2-methylidene-4-[(4-nitrophenyl)methoxy]-4-oxobutyl]-3-[(1S)-1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-4-oxoazetidin-1-yl]but-2-enoate.
| Compound Name | methyl 3-methyl-2-[2-[2-methylidene-4-[(4-nitrophenyl)methoxy]-4-oxobutyl]-3-[(1S)-1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-4-oxoazetidin-1-yl]but-2-enoate |
|---|---|
| PubChem CID | 57090914 |
| Molecular Formula | C31H33N3O12 |
| Molecular Weight | 639.61 g/mol |
| Exact Mass | 639.21 |
| IUPAC Name | methyl 3-methyl-2-[2-[2-methylidene-4-[(4-nitrophenyl)methoxy]-4-oxobutyl]-3-[(1S)-1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-4-oxoazetidin-1-yl]but-2-enoate |
| SMILES | C=C(CC(=O)OCc1ccc([N+](=O)[O-])cc1)CC1C([C@H](C)OC(=O)OCc2ccc([N+](=O)[O-])cc2)C(=O)N1C(C(=O)OC)=C(C)C |
| InChI | InChI=1S/C31H33N3O12/c1-18(2)28(30(37)43-5)32-25(14-19(3)15-26(35)44-16-21-6-10-23(11-7-21)33(39)40)27(29(32)36)20(4)46-31(38)45-17-22-8-12-24(13-9-22)34(41)42/h6-13,20,25,27H,3,14-17H2,1-2,4-5H3/t20-,25?,27?/m0/s1 |
| InChIKey | SRAGHNJGVLNFOC-LAWLFLRMSA-N |
| XLogP | 4.92 |
| TPSA | 194.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.61 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|