C27H26Cl2N2O10 — CID 57260354
methyl 2,3-dichloro-4-[(2R,3R)-1-[2-[(4-nitrophenyl)methoxy]-2-oxoethyl]-4-oxo-3-[(1R)-1-phenylmethoxycarbonyloxyethyl]azetidin-2-yl]but-2-enoate (PubChem CID 57260354) has the molecular formula C27H26Cl2N2O10 and a molecular weight of 609.42 g/mol. Its IUPAC name is methyl 2,3-dichloro-4-[(2R,3R)-1-[2-[(4-nitrophenyl)methoxy]-2-oxoethyl]-4-oxo-3-[(1R)-1-phenylmethoxycarbonyloxyethyl]azetidin-2-yl]but-2-enoate.
| Compound Name | methyl 2,3-dichloro-4-[(2R,3R)-1-[2-[(4-nitrophenyl)methoxy]-2-oxoethyl]-4-oxo-3-[(1R)-1-phenylmethoxycarbonyloxyethyl]azetidin-2-yl]but-2-enoate |
|---|---|
| PubChem CID | 57260354 |
| Molecular Formula | C27H26Cl2N2O10 |
| Molecular Weight | 609.42 g/mol |
| Exact Mass | 608.10 |
| IUPAC Name | methyl 2,3-dichloro-4-[(2R,3R)-1-[2-[(4-nitrophenyl)methoxy]-2-oxoethyl]-4-oxo-3-[(1R)-1-phenylmethoxycarbonyloxyethyl]azetidin-2-yl]but-2-enoate |
| SMILES | COC(=O)C(Cl)=C(Cl)C[C@@H]1[C@H]([C@@H](C)OC(=O)OCc2ccccc2)C(=O)N1CC(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H26Cl2N2O10/c1-16(41-27(35)40-15-17-6-4-3-5-7-17)23-21(12-20(28)24(29)26(34)38-2)30(25(23)33)13-22(32)39-14-18-8-10-19(11-9-18)31(36)37/h3-11,16,21,23H,12-15H2,1-2H3/t16-,21-,23+/m1/s1 |
| InChIKey | UGSJEZWKMOXVPO-VZPUWSDOSA-N |
| XLogP | 4.46 |
| TPSA | 151.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.42 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|