C25H30N2O10 — CID 56605580
methyl 2-[(2R,3S)-2-(4-methoxy-2-methylidene-4-oxobutyl)-3-[1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-4-oxoazetidin-1-yl]-3-methylbut-2-enoate (PubChem CID 56605580) has the molecular formula C25H30N2O10 and a molecular weight of 518.52 g/mol. Its IUPAC name is methyl 2-[(2R,3S)-2-(4-methoxy-2-methylidene-4-oxobutyl)-3-[1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-4-oxoazetidin-1-yl]-3-methylbut-2-enoate.
| Compound Name | methyl 2-[(2R,3S)-2-(4-methoxy-2-methylidene-4-oxobutyl)-3-[1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-4-oxoazetidin-1-yl]-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 56605580 |
| Molecular Formula | C25H30N2O10 |
| Molecular Weight | 518.52 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | methyl 2-[(2R,3S)-2-(4-methoxy-2-methylidene-4-oxobutyl)-3-[1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-4-oxoazetidin-1-yl]-3-methylbut-2-enoate |
| SMILES | C=C(CC(=O)OC)C[C@@H]1[C@@H](C(C)OC(=O)OCc2ccc([N+](=O)[O-])cc2)C(=O)N1C(C(=O)OC)=C(C)C |
| InChI | InChI=1S/C25H30N2O10/c1-14(2)22(24(30)35-6)26-19(11-15(3)12-20(28)34-5)21(23(26)29)16(4)37-25(31)36-13-17-7-9-18(10-8-17)27(32)33/h7-10,16,19,21H,3,11-13H2,1-2,4-6H3/t16?,19-,21-/m1/s1 |
| InChIKey | FDRDWJFXGFWCKB-MUVQZQTDSA-N |
| XLogP | 3.44 |
| TPSA | 151.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.52 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|