C30H35N3O10 — CID 88725088
(4-nitrophenyl)methyl 3-[[(2R,3S)-1-(3-methylbutan-2-yl)-3-[(1R)-1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-4-oxoazetidin-2-yl]methyl]but-3-enoate (PubChem CID 88725088) has the molecular formula C30H35N3O10 and a molecular weight of 597.62 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 3-[[(2R,3S)-1-(3-methylbutan-2-yl)-3-[(1R)-1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-4-oxoazetidin-2-yl]methyl]but-3-enoate.
| Compound Name | (4-nitrophenyl)methyl 3-[[(2R,3S)-1-(3-methylbutan-2-yl)-3-[(1R)-1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-4-oxoazetidin-2-yl]methyl]but-3-enoate |
|---|---|
| PubChem CID | 88725088 |
| Molecular Formula | C30H35N3O10 |
| Molecular Weight | 597.62 g/mol |
| Exact Mass | 597.23 |
| IUPAC Name | (4-nitrophenyl)methyl 3-[[(2R,3S)-1-(3-methylbutan-2-yl)-3-[(1R)-1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-4-oxoazetidin-2-yl]methyl]but-3-enoate |
| SMILES | C=C(CC(=O)OCc1ccc([N+](=O)[O-])cc1)C[C@@H]1[C@@H]([C@@H](C)OC(=O)OCc2ccc([N+](=O)[O-])cc2)C(=O)N1C(C)C(C)C |
| InChI | InChI=1S/C30H35N3O10/c1-18(2)20(4)31-26(14-19(3)15-27(34)41-16-22-6-10-24(11-7-22)32(37)38)28(29(31)35)21(5)43-30(36)42-17-23-8-12-25(13-9-23)33(39)40/h6-13,18,20-21,26,28H,3,14-17H2,1-2,4-5H3/t20?,21-,26-,28-/m1/s1 |
| InChIKey | KBOVDKUDUBWZOG-SZWICWSRSA-N |
| XLogP | 5.50 |
| TPSA | 168.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.62 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|