C40H42N2O11 — CID 88721958
1-[1-[1,3-bis(4-methoxyphenyl)propan-2-yl]-2-[1-[(4-methoxyphenyl)methoxy]-2-oxoethyl]-4-oxoazetidin-3-yl]ethyl (4-nitrophenyl)methyl carbonate (PubChem CID 88721958) has the molecular formula C40H42N2O11 and a molecular weight of 726.78 g/mol. Its IUPAC name is 1-[1-[1,3-bis(4-methoxyphenyl)propan-2-yl]-2-[1-[(4-methoxyphenyl)methoxy]-2-oxoethyl]-4-oxoazetidin-3-yl]ethyl (4-nitrophenyl)methyl carbonate.
| Compound Name | 1-[1-[1,3-bis(4-methoxyphenyl)propan-2-yl]-2-[1-[(4-methoxyphenyl)methoxy]-2-oxoethyl]-4-oxoazetidin-3-yl]ethyl (4-nitrophenyl)methyl carbonate |
|---|---|
| PubChem CID | 88721958 |
| Molecular Formula | C40H42N2O11 |
| Molecular Weight | 726.78 g/mol |
| Exact Mass | 726.28 |
| IUPAC Name | 1-[1-[1,3-bis(4-methoxyphenyl)propan-2-yl]-2-[1-[(4-methoxyphenyl)methoxy]-2-oxoethyl]-4-oxoazetidin-3-yl]ethyl (4-nitrophenyl)methyl carbonate |
| SMILES | COc1ccc(COC(C=O)C2C(C(C)OC(=O)OCc3ccc([N+](=O)[O-])cc3)C(=O)N2C(Cc2ccc(OC)cc2)Cc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C40H42N2O11/c1-26(53-40(45)52-25-29-5-13-31(14-6-29)42(46)47)37-38(36(23-43)51-24-30-11-19-35(50-4)20-12-30)41(39(37)44)32(21-27-7-15-33(48-2)16-8-27)22-28-9-17-34(49-3)18-10-28/h5-20,23,26,32,36-38H,21-22,24-25H2,1-4H3 |
| InChIKey | BRZDPSPTVUNKAD-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 152.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.78 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|