C31H34ClNO6 — CID 70356313
benzyl 1-[(2S,3S)-1-[bis(4-methoxyphenyl)methyl]-2-(1-chloropropan-2-yl)-4-oxoazetidin-3-yl]ethyl carbonate (PubChem CID 70356313) has the molecular formula C31H34ClNO6 and a molecular weight of 552.07 g/mol. Its IUPAC name is benzyl 1-[(2S,3S)-1-[bis(4-methoxyphenyl)methyl]-2-(1-chloropropan-2-yl)-4-oxoazetidin-3-yl]ethyl carbonate.
| Compound Name | benzyl 1-[(2S,3S)-1-[bis(4-methoxyphenyl)methyl]-2-(1-chloropropan-2-yl)-4-oxoazetidin-3-yl]ethyl carbonate |
|---|---|
| PubChem CID | 70356313 |
| Molecular Formula | C31H34ClNO6 |
| Molecular Weight | 552.07 g/mol |
| Exact Mass | 551.21 |
| IUPAC Name | benzyl 1-[(2S,3S)-1-[bis(4-methoxyphenyl)methyl]-2-(1-chloropropan-2-yl)-4-oxoazetidin-3-yl]ethyl carbonate |
| SMILES | COc1ccc(C(c2ccc(OC)cc2)N2C(=O)[C@H](C(C)OC(=O)OCc3ccccc3)[C@H]2C(C)CCl)cc1 |
| InChI | InChI=1S/C31H34ClNO6/c1-20(18-32)28-27(21(2)39-31(35)38-19-22-8-6-5-7-9-22)30(34)33(28)29(23-10-14-25(36-3)15-11-23)24-12-16-26(37-4)17-13-24/h5-17,20-21,27-29H,18-19H2,1-4H3/t20?,21?,27-,28-/m1/s1 |
| InChIKey | LPBBVZBJLXVGKR-BIGLUGCYSA-N |
| XLogP | 6.24 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.07 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|