C37H47NO7Si — CID 173345580
benzyl 1-[(2S,3S)-1-[bis(4-methoxyphenyl)methyl]-2-[(Z)-1-dimethylsilyloxy-4,4-dimethylpent-2-en-3-yl]-4-oxoazetidin-3-yl]ethyl carbonate (PubChem CID 173345580) has the molecular formula C37H47NO7Si and a molecular weight of 645.87 g/mol. Its IUPAC name is benzyl 1-[(2S,3S)-1-[bis(4-methoxyphenyl)methyl]-2-[(Z)-1-dimethylsilyloxy-4,4-dimethylpent-2-en-3-yl]-4-oxoazetidin-3-yl]ethyl carbonate.
| Compound Name | benzyl 1-[(2S,3S)-1-[bis(4-methoxyphenyl)methyl]-2-[(Z)-1-dimethylsilyloxy-4,4-dimethylpent-2-en-3-yl]-4-oxoazetidin-3-yl]ethyl carbonate |
|---|---|
| PubChem CID | 173345580 |
| Molecular Formula | C37H47NO7Si |
| Molecular Weight | 645.87 g/mol |
| Exact Mass | 645.31 |
| IUPAC Name | benzyl 1-[(2S,3S)-1-[bis(4-methoxyphenyl)methyl]-2-[(Z)-1-dimethylsilyloxy-4,4-dimethylpent-2-en-3-yl]-4-oxoazetidin-3-yl]ethyl carbonate |
| SMILES | COc1ccc(C(c2ccc(OC)cc2)N2C(=O)[C@H](C(C)OC(=O)OCc3ccccc3)[C@H]2/C(=C\CO[SiH](C)C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C37H47NO7Si/c1-25(45-36(40)43-24-26-12-10-9-11-13-26)32-34(31(37(2,3)4)22-23-44-46(7)8)38(35(32)39)33(27-14-18-29(41-5)19-15-27)28-16-20-30(42-6)21-17-28/h9-22,25,32-34,46H,23-24H2,1-8H3/b31-22+/t25?,32-,34-/m1/s1 |
| InChIKey | RXCZHFHIIYERCV-PUHZYVQCSA-N |
| XLogP | 7.33 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.87 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|