C39H51NO7Si — CID 154317029
benzyl [(1R)-1-[(3S,4S)-1-[1,3-bis(4-methoxyphenyl)propan-2-yl]-2-oxo-4-(2,2,5-trimethyl-5-silyloxyhex-3-en-3-yl)azetidin-3-yl]ethyl] carbonate (PubChem CID 154317029) has the molecular formula C39H51NO7Si and a molecular weight of 673.92 g/mol. Its IUPAC name is benzyl [(1R)-1-[(3S,4S)-1-[1,3-bis(4-methoxyphenyl)propan-2-yl]-2-oxo-4-(2,2,5-trimethyl-5-silyloxyhex-3-en-3-yl)azetidin-3-yl]ethyl] carbonate.
| Compound Name | benzyl [(1R)-1-[(3S,4S)-1-[1,3-bis(4-methoxyphenyl)propan-2-yl]-2-oxo-4-(2,2,5-trimethyl-5-silyloxyhex-3-en-3-yl)azetidin-3-yl]ethyl] carbonate |
|---|---|
| PubChem CID | 154317029 |
| Molecular Formula | C39H51NO7Si |
| Molecular Weight | 673.92 g/mol |
| Exact Mass | 673.34 |
| IUPAC Name | benzyl [(1R)-1-[(3S,4S)-1-[1,3-bis(4-methoxyphenyl)propan-2-yl]-2-oxo-4-(2,2,5-trimethyl-5-silyloxyhex-3-en-3-yl)azetidin-3-yl]ethyl] carbonate |
| SMILES | COc1ccc(CC(Cc2ccc(OC)cc2)N2C(=O)[C@H]([C@@H](C)OC(=O)OCc3ccccc3)[C@H]2C(=CC(C)(C)O[SiH3])C(C)(C)C)cc1 |
| InChI | InChI=1S/C39H51NO7Si/c1-26(46-37(42)45-25-29-12-10-9-11-13-29)34-35(33(38(2,3)4)24-39(5,6)47-48)40(36(34)41)30(22-27-14-18-31(43-7)19-15-27)23-28-16-20-32(44-8)21-17-28/h9-21,24,26,30,34-35H,22-23,25H2,1-8,48H3/t26-,34-,35-/m1/s1 |
| InChIKey | HRVGNGJAMUQJBV-DTTZNNBASA-N |
| XLogP | 6.47 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.92 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|