C27H35NO6 — CID 57067780
butyl 1-[1,3-bis(4-methoxyphenyl)propan-2-yl]-3-(1-hydroxyethyl)-4-oxoazetidine-2-carboxylate (PubChem CID 57067780) has the molecular formula C27H35NO6 and a molecular weight of 469.58 g/mol. Its IUPAC name is butyl 1-[1,3-bis(4-methoxyphenyl)propan-2-yl]-3-(1-hydroxyethyl)-4-oxoazetidine-2-carboxylate.
| Compound Name | butyl 1-[1,3-bis(4-methoxyphenyl)propan-2-yl]-3-(1-hydroxyethyl)-4-oxoazetidine-2-carboxylate |
|---|---|
| PubChem CID | 57067780 |
| Molecular Formula | C27H35NO6 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | butyl 1-[1,3-bis(4-methoxyphenyl)propan-2-yl]-3-(1-hydroxyethyl)-4-oxoazetidine-2-carboxylate |
| SMILES | CCCCOC(=O)C1C(C(C)O)C(=O)N1C(Cc1ccc(OC)cc1)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C27H35NO6/c1-5-6-15-34-27(31)25-24(18(2)29)26(30)28(25)21(16-19-7-11-22(32-3)12-8-19)17-20-9-13-23(33-4)14-10-20/h7-14,18,21,24-25,29H,5-6,15-17H2,1-4H3 |
| InChIKey | SFYPGMOOWWMELR-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|