C24H29NO5 — CID 74001429
benzyl 1-[2-(1-hydroxy-2-methyl-3-phenylbutan-2-yl)-4-oxoazetidin-3-yl]ethyl carbonate (PubChem CID 74001429) has the molecular formula C24H29NO5 and a molecular weight of 411.50 g/mol. Its IUPAC name is benzyl 1-[2-(1-hydroxy-2-methyl-3-phenylbutan-2-yl)-4-oxoazetidin-3-yl]ethyl carbonate.
| Compound Name | benzyl 1-[2-(1-hydroxy-2-methyl-3-phenylbutan-2-yl)-4-oxoazetidin-3-yl]ethyl carbonate |
|---|---|
| PubChem CID | 74001429 |
| Molecular Formula | C24H29NO5 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | benzyl 1-[2-(1-hydroxy-2-methyl-3-phenylbutan-2-yl)-4-oxoazetidin-3-yl]ethyl carbonate |
| SMILES | CC(OC(=O)OCc1ccccc1)C1C(=O)NC1C(C)(CO)C(C)c1ccccc1 |
| InChI | InChI=1S/C24H29NO5/c1-16(19-12-8-5-9-13-19)24(3,15-26)21-20(22(27)25-21)17(2)30-23(28)29-14-18-10-6-4-7-11-18/h4-13,16-17,20-21,26H,14-15H2,1-3H3,(H,25,27) |
| InChIKey | RFFNJXMAJKOHLJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |