C17H20N2O7 — CID 70552714
1-[2-[1-(hydroxymethyl)cyclopropyl]-4-oxoazetidin-3-yl]ethyl (4-nitrophenyl)methyl carbonate (PubChem CID 70552714) has the molecular formula C17H20N2O7 and a molecular weight of 364.35 g/mol. Its IUPAC name is 1-[2-[1-(hydroxymethyl)cyclopropyl]-4-oxoazetidin-3-yl]ethyl (4-nitrophenyl)methyl carbonate.
| Compound Name | 1-[2-[1-(hydroxymethyl)cyclopropyl]-4-oxoazetidin-3-yl]ethyl (4-nitrophenyl)methyl carbonate |
|---|---|
| PubChem CID | 70552714 |
| Molecular Formula | C17H20N2O7 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 1-[2-[1-(hydroxymethyl)cyclopropyl]-4-oxoazetidin-3-yl]ethyl (4-nitrophenyl)methyl carbonate |
| SMILES | CC(OC(=O)OCc1ccc([N+](=O)[O-])cc1)C1C(=O)NC1C1(CO)CC1 |
| InChI | InChI=1S/C17H20N2O7/c1-10(13-14(18-15(13)21)17(9-20)6-7-17)26-16(22)25-8-11-2-4-12(5-3-11)19(23)24/h2-5,10,13-14,20H,6-9H2,1H3,(H,18,21) |
| InChIKey | PWDFQSDYKBEPIY-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|