C18H19NO6 — CID 142660005
(4-nitrophenyl)methyl 3-(1-hydroxyethyl)-1-methyl-4-oxobicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 142660005) has the molecular formula C18H19NO6 and a molecular weight of 345.35 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 3-(1-hydroxyethyl)-1-methyl-4-oxobicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 3-(1-hydroxyethyl)-1-methyl-4-oxobicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 142660005 |
| Molecular Formula | C18H19NO6 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | (4-nitrophenyl)methyl 3-(1-hydroxyethyl)-1-methyl-4-oxobicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | CC(O)C1=C(C(=O)OCc2ccc([N+](=O)[O-])cc2)C2(C)CCC2C1=O |
| InChI | InChI=1S/C18H19NO6/c1-10(20)14-15(18(2)8-7-13(18)16(14)21)17(22)25-9-11-3-5-12(6-4-11)19(23)24/h3-6,10,13,20H,7-9H2,1-2H3 |
| InChIKey | IGGBKXMQBAQLOH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|