C17H18N2O7 — CID 14394982
(4-nitrophenyl)methyl 6-(1-hydroxyethyl)-5-methyl-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 14394982) has the molecular formula C17H18N2O7 and a molecular weight of 362.34 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 6-(1-hydroxyethyl)-5-methyl-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 6-(1-hydroxyethyl)-5-methyl-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 14394982 |
| Molecular Formula | C17H18N2O7 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | (4-nitrophenyl)methyl 6-(1-hydroxyethyl)-5-methyl-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC(O)C1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)C(=O)CC12C |
| InChI | InChI=1S/C17H18N2O7/c1-9(20)13-15(22)18-14(12(21)7-17(13,18)2)16(23)26-8-10-3-5-11(6-4-10)19(24)25/h3-6,9,13-14,20H,7-8H2,1-2H3 |
| InChIKey | UNHMCPQTOJNXJQ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 127.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|