C21H18N4O11 — CID 139760212
3-O-methyl 1-O,2-O-bis[(4-nitrophenyl)methyl] 4-oxopyrazolidine-1,2,3-tricarboxylate (PubChem CID 139760212) has the molecular formula C21H18N4O11 and a molecular weight of 502.39 g/mol. Its IUPAC name is 3-O-methyl 1-O,2-O-bis[(4-nitrophenyl)methyl] 4-oxopyrazolidine-1,2,3-tricarboxylate.
| Compound Name | 3-O-methyl 1-O,2-O-bis[(4-nitrophenyl)methyl] 4-oxopyrazolidine-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 139760212 |
| Molecular Formula | C21H18N4O11 |
| Molecular Weight | 502.39 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | 3-O-methyl 1-O,2-O-bis[(4-nitrophenyl)methyl] 4-oxopyrazolidine-1,2,3-tricarboxylate |
| SMILES | COC(=O)C1C(=O)CN(C(=O)OCc2ccc([N+](=O)[O-])cc2)N1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H18N4O11/c1-34-19(27)18-17(26)10-22(20(28)35-11-13-2-6-15(7-3-13)24(30)31)23(18)21(29)36-12-14-4-8-16(9-5-14)25(32)33/h2-9,18H,10-12H2,1H3 |
| InChIKey | BZNHAYYDECVQGN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 188.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|