C17H17N3O5 — CID 129434482
(4-nitrophenyl)methyl (1S,2S,3R,7R)-3,9-dimethyl-4-oxo-5,6-diazatricyclo[5.2.0.02,5]non-8-ene-6-carboxylate (PubChem CID 129434482) has the molecular formula C17H17N3O5 and a molecular weight of 343.34 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (1S,2S,3R,7R)-3,9-dimethyl-4-oxo-5,6-diazatricyclo[5.2.0.02,5]non-8-ene-6-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (1S,2S,3R,7R)-3,9-dimethyl-4-oxo-5,6-diazatricyclo[5.2.0.02,5]non-8-ene-6-carboxylate |
|---|---|
| PubChem CID | 129434482 |
| Molecular Formula | C17H17N3O5 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | (4-nitrophenyl)methyl (1S,2S,3R,7R)-3,9-dimethyl-4-oxo-5,6-diazatricyclo[5.2.0.02,5]non-8-ene-6-carboxylate |
| SMILES | CC1=C[C@@H]2[C@@H]1[C@H]1[C@@H](C)C(=O)N1N2C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H17N3O5/c1-9-7-13-14(9)15-10(2)16(21)19(15)18(13)17(22)25-8-11-3-5-12(6-4-11)20(23)24/h3-7,10,13-15H,8H2,1-2H3/t10-,13-,14-,15-/m1/s1 |
| InChIKey | UTKKRLWWBVKXAE-JUDXGUMMSA-N |
| XLogP | 2.25 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|