C22H21N3O8 — CID 122231594
(4-nitrophenyl)methyl (2R,5R,6S)-2-anilinooxy-6-[(1R)-1-hydroxyethyl]-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 122231594) has the molecular formula C22H21N3O8 and a molecular weight of 455.42 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2R,5R,6S)-2-anilinooxy-6-[(1R)-1-hydroxyethyl]-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2R,5R,6S)-2-anilinooxy-6-[(1R)-1-hydroxyethyl]-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 122231594 |
| Molecular Formula | C22H21N3O8 |
| Molecular Weight | 455.42 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | (4-nitrophenyl)methyl (2R,5R,6S)-2-anilinooxy-6-[(1R)-1-hydroxyethyl]-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | C[C@@H](O)[C@H]1C(=O)N2[C@@H]1CC(=O)[C@@]2(ONc1ccccc1)C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H21N3O8/c1-13(26)19-17-11-18(27)22(24(17)20(19)28,33-23-15-5-3-2-4-6-15)21(29)32-12-14-7-9-16(10-8-14)25(30)31/h2-10,13,17,19,23,26H,11-12H2,1H3/t13-,17-,19-,22-/m1/s1 |
| InChIKey | QOSBWDJCSRYNQR-RUERPSORSA-N |
| XLogP | 1.56 |
| TPSA | 148.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.42 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|