C27H25N3O7 — CID 102364019
(4-nitrophenyl)methyl (2S,5R,6S)-6-[(1R)-1-hydroxyethyl]-2-[(naphthalen-2-ylamino)methyl]-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 102364019) has the molecular formula C27H25N3O7 and a molecular weight of 503.51 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,5R,6S)-6-[(1R)-1-hydroxyethyl]-2-[(naphthalen-2-ylamino)methyl]-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,5R,6S)-6-[(1R)-1-hydroxyethyl]-2-[(naphthalen-2-ylamino)methyl]-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 102364019 |
| Molecular Formula | C27H25N3O7 |
| Molecular Weight | 503.51 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,5R,6S)-6-[(1R)-1-hydroxyethyl]-2-[(naphthalen-2-ylamino)methyl]-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | C[C@@H](O)[C@H]1C(=O)N2[C@@H]1CC(=O)[C@@]2(CNc1ccc2ccccc2c1)C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H25N3O7/c1-16(31)24-22-13-23(32)27(29(22)25(24)33,15-28-20-9-8-18-4-2-3-5-19(18)12-20)26(34)37-14-17-6-10-21(11-7-17)30(35)36/h2-12,16,22,24,28,31H,13-15H2,1H3/t16-,22-,24-,27+/m1/s1 |
| InChIKey | PSXBUYFGGDTDDA-CJNIISRUSA-N |
| XLogP | 2.82 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.51 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|