C25H27N3O7 — CID 102364025
(4-nitrophenyl)methyl (1R,5S,6R)-5-[(1R)-1-hydroxyethyl]-4,8-dioxo-3-(2-phenylethyl)-3,9-diazabicyclo[4.2.1]nonane-1-carboxylate (PubChem CID 102364025) has the molecular formula C25H27N3O7 and a molecular weight of 481.51 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (1R,5S,6R)-5-[(1R)-1-hydroxyethyl]-4,8-dioxo-3-(2-phenylethyl)-3,9-diazabicyclo[4.2.1]nonane-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (1R,5S,6R)-5-[(1R)-1-hydroxyethyl]-4,8-dioxo-3-(2-phenylethyl)-3,9-diazabicyclo[4.2.1]nonane-1-carboxylate |
|---|---|
| PubChem CID | 102364025 |
| Molecular Formula | C25H27N3O7 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | (4-nitrophenyl)methyl (1R,5S,6R)-5-[(1R)-1-hydroxyethyl]-4,8-dioxo-3-(2-phenylethyl)-3,9-diazabicyclo[4.2.1]nonane-1-carboxylate |
| SMILES | C[C@@H](O)[C@H]1C(=O)N(CCc2ccccc2)C[C@@]2(C(=O)OCc3ccc([N+](=O)[O-])cc3)N[C@@H]1CC2=O |
| InChI | InChI=1S/C25H27N3O7/c1-16(29)22-20-13-21(30)25(26-20,15-27(23(22)31)12-11-17-5-3-2-4-6-17)24(32)35-14-18-7-9-19(10-8-18)28(33)34/h2-10,16,20,22,26,29H,11-15H2,1H3/t16-,20-,22-,25-/m1/s1 |
| InChIKey | ZWRSEIYFEKPYSF-YBXFAYSSSA-N |
| XLogP | 1.39 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|