C28H27N3O6 — CID 71552637
(4-methoxyphenyl)methyl 4-methyl-3-[2-(4-nitrophenyl)ethyl]-2-oxo-6-phenyl-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 71552637) has the molecular formula C28H27N3O6 and a molecular weight of 501.54 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 4-methyl-3-[2-(4-nitrophenyl)ethyl]-2-oxo-6-phenyl-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | (4-methoxyphenyl)methyl 4-methyl-3-[2-(4-nitrophenyl)ethyl]-2-oxo-6-phenyl-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 71552637 |
| Molecular Formula | C28H27N3O6 |
| Molecular Weight | 501.54 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | (4-methoxyphenyl)methyl 4-methyl-3-[2-(4-nitrophenyl)ethyl]-2-oxo-6-phenyl-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | COc1ccc(COC(=O)C2=C(C)N(CCc3ccc([N+](=O)[O-])cc3)C(=O)NC2c2ccccc2)cc1 |
| InChI | InChI=1S/C28H27N3O6/c1-19-25(27(32)37-18-21-10-14-24(36-2)15-11-21)26(22-6-4-3-5-7-22)29-28(33)30(19)17-16-20-8-12-23(13-9-20)31(34)35/h3-15,26H,16-18H2,1-2H3,(H,29,33) |
| InChIKey | RLAGGTFGXBSNSA-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.54 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|