C30H32N2O4 — CID 71552797
(4-methoxyphenyl)methyl 4-methyl-2-oxo-6-phenyl-3-(4-phenylbutyl)-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 71552797) has the molecular formula C30H32N2O4 and a molecular weight of 484.60 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 4-methyl-2-oxo-6-phenyl-3-(4-phenylbutyl)-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | (4-methoxyphenyl)methyl 4-methyl-2-oxo-6-phenyl-3-(4-phenylbutyl)-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 71552797 |
| Molecular Formula | C30H32N2O4 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | (4-methoxyphenyl)methyl 4-methyl-2-oxo-6-phenyl-3-(4-phenylbutyl)-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | COc1ccc(COC(=O)C2=C(C)N(CCCCc3ccccc3)C(=O)NC2c2ccccc2)cc1 |
| InChI | InChI=1S/C30H32N2O4/c1-22-27(29(33)36-21-24-16-18-26(35-2)19-17-24)28(25-14-7-4-8-15-25)31-30(34)32(22)20-10-9-13-23-11-5-3-6-12-23/h3-8,11-12,14-19,28H,9-10,13,20-21H2,1-2H3,(H,31,34) |
| InChIKey | GGNIXMVCBCETIM-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|