C24H24ClN3O7 — CID 102364023
(4-nitrophenyl)methyl (1R,5S,6R)-3-[(4-chlorophenyl)methyl]-5-[(1R)-1-hydroxyethyl]-4,8-dioxo-3,9-diazabicyclo[4.2.1]nonane-1-carboxylate (PubChem CID 102364023) has the molecular formula C24H24ClN3O7 and a molecular weight of 501.92 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (1R,5S,6R)-3-[(4-chlorophenyl)methyl]-5-[(1R)-1-hydroxyethyl]-4,8-dioxo-3,9-diazabicyclo[4.2.1]nonane-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (1R,5S,6R)-3-[(4-chlorophenyl)methyl]-5-[(1R)-1-hydroxyethyl]-4,8-dioxo-3,9-diazabicyclo[4.2.1]nonane-1-carboxylate |
|---|---|
| PubChem CID | 102364023 |
| Molecular Formula | C24H24ClN3O7 |
| Molecular Weight | 501.92 g/mol |
| Exact Mass | 501.13 |
| IUPAC Name | (4-nitrophenyl)methyl (1R,5S,6R)-3-[(4-chlorophenyl)methyl]-5-[(1R)-1-hydroxyethyl]-4,8-dioxo-3,9-diazabicyclo[4.2.1]nonane-1-carboxylate |
| SMILES | C[C@@H](O)[C@H]1C(=O)N(Cc2ccc(Cl)cc2)C[C@@]2(C(=O)OCc3ccc([N+](=O)[O-])cc3)N[C@@H]1CC2=O |
| InChI | InChI=1S/C24H24ClN3O7/c1-14(29)21-19-10-20(30)24(26-19,13-27(22(21)31)11-15-2-6-17(25)7-3-15)23(32)35-12-16-4-8-18(9-5-16)28(33)34/h2-9,14,19,21,26,29H,10-13H2,1H3/t14-,19-,21-,24-/m1/s1 |
| InChIKey | KUNJQPPLVIRLFV-LHHVBVAPSA-N |
| XLogP | 2.00 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.92 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|