C19H15ClN2O6 — CID 100954233
(4-nitrophenyl)methyl (2R,3S,5R)-3-(4-chlorophenyl)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 100954233) has the molecular formula C19H15ClN2O6 and a molecular weight of 402.79 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2R,3S,5R)-3-(4-chlorophenyl)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2R,3S,5R)-3-(4-chlorophenyl)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 100954233 |
| Molecular Formula | C19H15ClN2O6 |
| Molecular Weight | 402.79 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | (4-nitrophenyl)methyl (2R,3S,5R)-3-(4-chlorophenyl)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | O=C(OCc1ccc([N+](=O)[O-])cc1)[C@H]1[C@H](c2ccc(Cl)cc2)O[C@@H]2CC(=O)N21 |
| InChI | InChI=1S/C19H15ClN2O6/c20-13-5-3-12(4-6-13)18-17(21-15(23)9-16(21)28-18)19(24)27-10-11-1-7-14(8-2-11)22(25)26/h1-8,16-18H,9-10H2/t16-,17-,18+/m1/s1 |
| InChIKey | FDGSPEBJYFMPKP-KURKYZTESA-N |
| XLogP | 2.99 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.79 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|