C15H14N2O7 — CID 123713336
(4-nitrophenyl)methyl (2R)-3-(2-hydroxyethylidene)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 123713336) has the molecular formula C15H14N2O7 and a molecular weight of 334.28 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2R)-3-(2-hydroxyethylidene)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2R)-3-(2-hydroxyethylidene)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 123713336 |
| Molecular Formula | C15H14N2O7 |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | (4-nitrophenyl)methyl (2R)-3-(2-hydroxyethylidene)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | O=C(OCc1ccc([N+](=O)[O-])cc1)[C@H]1C(=CCO)OC2CC(=O)N21 |
| InChI | InChI=1S/C15H14N2O7/c18-6-5-11-14(16-12(19)7-13(16)24-11)15(20)23-8-9-1-3-10(4-2-9)17(21)22/h1-5,13-14,18H,6-8H2/t13?,14-/m1/s1 |
| InChIKey | JKDJFJKHUGAVTJ-ARLHGKGLSA-N |
| XLogP | 0.47 |
| TPSA | 119.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|