C18H18N2O5S2 — CID 70609264
(4-nitrophenyl)methyl (3Z)-7-oxo-3-(2-prop-2-enylsulfanylethylidene)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 70609264) has the molecular formula C18H18N2O5S2 and a molecular weight of 406.49 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (3Z)-7-oxo-3-(2-prop-2-enylsulfanylethylidene)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (3Z)-7-oxo-3-(2-prop-2-enylsulfanylethylidene)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 70609264 |
| Molecular Formula | C18H18N2O5S2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | (4-nitrophenyl)methyl (3Z)-7-oxo-3-(2-prop-2-enylsulfanylethylidene)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | C=CCSC/C=C1\SC2CC(=O)N2C1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H18N2O5S2/c1-2-8-26-9-7-14-17(19-15(21)10-16(19)27-14)18(22)25-11-12-3-5-13(6-4-12)20(23)24/h2-7,16-17H,1,8-11H2/b14-7- |
| InChIKey | IXYGHKZQRAZICC-AUWJEWJLSA-N |
| XLogP | 3.11 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|