C21H19NO6 — CID 22748566
dibenzyl 7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2,3-dicarboxylate (PubChem CID 22748566) has the molecular formula C21H19NO6 and a molecular weight of 381.38 g/mol. Its IUPAC name is dibenzyl 7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2,3-dicarboxylate.
| Compound Name | dibenzyl 7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 22748566 |
| Molecular Formula | C21H19NO6 |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | dibenzyl 7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2,3-dicarboxylate |
| SMILES | O=C(OCc1ccccc1)C1OC2CC(=O)N2C1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H19NO6/c23-16-11-17-22(16)18(20(24)26-12-14-7-3-1-4-8-14)19(28-17)21(25)27-13-15-9-5-2-6-10-15/h1-10,17-19H,11-13H2 |
| InChIKey | ZZKNJWHEDCSFRS-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |