C21H19NO4 — CID 70590733
benzyl (2E)-2-(2-methyl-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptan-3-ylidene)-2-phenylacetate (PubChem CID 70590733) has the molecular formula C21H19NO4 and a molecular weight of 349.39 g/mol. Its IUPAC name is benzyl (2E)-2-(2-methyl-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptan-3-ylidene)-2-phenylacetate.
| Compound Name | benzyl (2E)-2-(2-methyl-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptan-3-ylidene)-2-phenylacetate |
|---|---|
| PubChem CID | 70590733 |
| Molecular Formula | C21H19NO4 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | benzyl (2E)-2-(2-methyl-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptan-3-ylidene)-2-phenylacetate |
| SMILES | CC1/C(=C(\C(=O)OCc2ccccc2)c2ccccc2)OC2CC(=O)N21 |
| InChI | InChI=1S/C21H19NO4/c1-14-20(26-18-12-17(23)22(14)18)19(16-10-6-3-7-11-16)21(24)25-13-15-8-4-2-5-9-15/h2-11,14,18H,12-13H2,1H3/b20-19+ |
| InChIKey | XMOZYSOGZHNZPC-FMQUCBEESA-N |
| XLogP | 3.12 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|