C18H15NO4S — CID 54494614
benzyl 2-(7-oxo-4-oxa-1-azabicyclo[3.2.0]heptan-3-ylidene)-2-thiophen-3-ylacetate (PubChem CID 54494614) has the molecular formula C18H15NO4S and a molecular weight of 341.39 g/mol. Its IUPAC name is benzyl 2-(7-oxo-4-oxa-1-azabicyclo[3.2.0]heptan-3-ylidene)-2-thiophen-3-ylacetate.
| Compound Name | benzyl 2-(7-oxo-4-oxa-1-azabicyclo[3.2.0]heptan-3-ylidene)-2-thiophen-3-ylacetate |
|---|---|
| PubChem CID | 54494614 |
| Molecular Formula | C18H15NO4S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | benzyl 2-(7-oxo-4-oxa-1-azabicyclo[3.2.0]heptan-3-ylidene)-2-thiophen-3-ylacetate |
| SMILES | O=C(OCc1ccccc1)C(=C1CN2C(=O)CC2O1)c1ccsc1 |
| InChI | InChI=1S/C18H15NO4S/c20-15-8-16-19(15)9-14(23-16)17(13-6-7-24-11-13)18(21)22-10-12-4-2-1-3-5-12/h1-7,11,16H,8-10H2 |
| InChIKey | XYDZOAHWRDIDPL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|