C15H13NO5 — CID 123501088
benzyl (5R)-7-oxo-3-(2-oxoethyl)-4-oxa-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 123501088) has the molecular formula C15H13NO5 and a molecular weight of 287.27 g/mol. Its IUPAC name is benzyl (5R)-7-oxo-3-(2-oxoethyl)-4-oxa-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | benzyl (5R)-7-oxo-3-(2-oxoethyl)-4-oxa-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 123501088 |
| Molecular Formula | C15H13NO5 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | benzyl (5R)-7-oxo-3-(2-oxoethyl)-4-oxa-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | O=CCC1=C(C(=O)OCc2ccccc2)N2C(=O)C[C@H]2O1 |
| InChI | InChI=1S/C15H13NO5/c17-7-6-11-14(16-12(18)8-13(16)21-11)15(19)20-9-10-4-2-1-3-5-10/h1-5,7,13H,6,8-9H2/t13-/m1/s1 |
| InChIKey | QFYISZNZSKOXFW-CYBMUJFWSA-N |
| XLogP | 1.12 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|