C15H13NO6 — CID 67036081
benzyl [(5R)-3-(2-hydroxyethenyl)-7-oxo-4-oxa-1-azabicyclo[3.2.0]hept-2-en-2-yl] carbonate (PubChem CID 67036081) has the molecular formula C15H13NO6 and a molecular weight of 303.27 g/mol. Its IUPAC name is benzyl [(5R)-3-(2-hydroxyethenyl)-7-oxo-4-oxa-1-azabicyclo[3.2.0]hept-2-en-2-yl] carbonate.
| Compound Name | benzyl [(5R)-3-(2-hydroxyethenyl)-7-oxo-4-oxa-1-azabicyclo[3.2.0]hept-2-en-2-yl] carbonate |
|---|---|
| PubChem CID | 67036081 |
| Molecular Formula | C15H13NO6 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | benzyl [(5R)-3-(2-hydroxyethenyl)-7-oxo-4-oxa-1-azabicyclo[3.2.0]hept-2-en-2-yl] carbonate |
| SMILES | O=C(OCc1ccccc1)OC1=C(C=CO)O[C@@H]2CC(=O)N12 |
| InChI | InChI=1S/C15H13NO6/c17-7-6-11-14(16-12(18)8-13(16)21-11)22-15(19)20-9-10-4-2-1-3-5-10/h1-7,13,17H,8-9H2/t13-/m1/s1 |
| InChIKey | CPCDGHIBNFAHBI-CYBMUJFWSA-N |
| XLogP | 2.17 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|